About 5-bromo-2,3-dihydropyrrolizin-1-one;2,3-dihydropyrrolizin-1-one;methane
5-bromo-2,3-dihydropyrrolizin-1-one;2,3-dihydropyrrolizin-1-one;methane (PubChem CID 157368615) has the molecular formula C16H21BrN2O2
and a molecular weight of 353.26 g/mol. Its IUPAC name is 5-bromo-2,3-dihydropyrrolizin-1-one;2,3-dihydropyrrolizin-1-one;methane.
Molecular Properties
| Compound Name | 5-bromo-2,3-dihydropyrrolizin-1-one;2,3-dihydropyrrolizin-1-one;methane |
| PubChem CID | 157368615 |
| Molecular Formula | C16H21BrN2O2 |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 5-bromo-2,3-dihydropyrrolizin-1-one;2,3-dihydropyrrolizin-1-one;methane |
| SMILES | C.C.O=C1CCn2c(Br)ccc21.O=C1CCn2cccc21 |
| InChI | InChI=1S/C7H6BrNO.C7H7NO.2CH4/c8-7-2-1-5-6(10)3-4-9(5)7;9-7-3-5-8-4-1-2-6(7)8;;/h1-2H,3-4H2;1-2,4H,3,5H2;2*1H4 |
| InChIKey | BJMGPVZERNMBFA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-2,3-dihydropyrrolizin-1-one;2,3-dihydropyrrolizin-1-one;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2,3-dihydropyrrolizin-1-one;2,3-dihydropyrrolizin-1-one;methane?
The IUPAC name of 5-bromo-2,3-dihydropyrrolizin-1-one;2,3-dihydropyrrolizin-1-one;methane (CID 157368615) is 5-bromo-2,3-dihydropyrrolizin-1-one;2,3-dihydropyrrolizin-1-one;methane.
What is the SMILES notation for 5-bromo-2,3-dihydropyrrolizin-1-one;2,3-dihydropyrrolizin-1-one;methane?
The canonical SMILES for 5-bromo-2,3-dihydropyrrolizin-1-one;2,3-dihydropyrrolizin-1-one;methane is C.C.O=C1CCn2c(Br)ccc21.O=C1CCn2cccc21.
What is the InChIKey of 5-bromo-2,3-dihydropyrrolizin-1-one;2,3-dihydropyrrolizin-1-one;methane?
The InChIKey is BJMGPVZERNMBFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrNO.C7H7NO.2CH4/c8-7-2-1-5-6(10)3-4-9(5)7;9-7-3-5-8-4-1-2-6(7)8;;/h1-2H,3-4H2;1-2,4H,3,5H2;2*1H4.
What are the key properties of 5-bromo-2,3-dihydropyrrolizin-1-one;2,3-dihydropyrrolizin-1-one;methane?
5-bromo-2,3-dihydropyrrolizin-1-one;2,3-dihydropyrrolizin-1-one;methane has a molecular weight of 353.26 g/mol, XLogP of 4.18, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2,3-dihydropyrrolizin-1-one;2,3-dihydropyrrolizin-1-one;methane is sourced from PubChem (CID 157368615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).