About carbon dioxide;2-chloro-4-[5-[3-chloro-5-(difluoromethoxy)phenyl]pyrazol-1-yl]pyridine
carbon dioxide;2-chloro-4-[5-[3-chloro-5-(difluoromethoxy)phenyl]pyrazol-1-yl]pyridine (PubChem CID 157368984) has the molecular formula C16H9Cl2F2N3O3
and a molecular weight of 400.17 g/mol. Its IUPAC name is carbon dioxide;2-chloro-4-[5-[3-chloro-5-(difluoromethoxy)phenyl]pyrazol-1-yl]pyridine.
Molecular Properties
| Compound Name | carbon dioxide;2-chloro-4-[5-[3-chloro-5-(difluoromethoxy)phenyl]pyrazol-1-yl]pyridine |
| PubChem CID | 157368984 |
| Molecular Formula | C16H9Cl2F2N3O3 |
| Molecular Weight | 400.17 g/mol |
| Exact Mass | 399.00 |
| IUPAC Name | carbon dioxide;2-chloro-4-[5-[3-chloro-5-(difluoromethoxy)phenyl]pyrazol-1-yl]pyridine |
| SMILES | FC(F)Oc1cc(Cl)cc(-c2ccnn2-c2ccnc(Cl)c2)c1.O=C=O |
| InChI | InChI=1S/C15H9Cl2F2N3O.CO2/c16-10-5-9(6-12(7-10)23-15(18)19)13-2-4-21-22(13)11-1-3-20-14(17)8-11;2-1-3/h1-8,15H; |
| InChIKey | BJNIQYCNVSOPNW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.17 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze carbon dioxide;2-chloro-4-[5-[3-chloro-5-(difluoromethoxy)phenyl]pyrazol-1-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;2-chloro-4-[5-[3-chloro-5-(difluoromethoxy)phenyl]pyrazol-1-yl]pyridine?
The IUPAC name of carbon dioxide;2-chloro-4-[5-[3-chloro-5-(difluoromethoxy)phenyl]pyrazol-1-yl]pyridine (CID 157368984) is carbon dioxide;2-chloro-4-[5-[3-chloro-5-(difluoromethoxy)phenyl]pyrazol-1-yl]pyridine.
What is the SMILES notation for carbon dioxide;2-chloro-4-[5-[3-chloro-5-(difluoromethoxy)phenyl]pyrazol-1-yl]pyridine?
The canonical SMILES for carbon dioxide;2-chloro-4-[5-[3-chloro-5-(difluoromethoxy)phenyl]pyrazol-1-yl]pyridine is FC(F)Oc1cc(Cl)cc(-c2ccnn2-c2ccnc(Cl)c2)c1.O=C=O.
What is the InChIKey of carbon dioxide;2-chloro-4-[5-[3-chloro-5-(difluoromethoxy)phenyl]pyrazol-1-yl]pyridine?
The InChIKey is BJNIQYCNVSOPNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9Cl2F2N3O.CO2/c16-10-5-9(6-12(7-10)23-15(18)19)13-2-4-21-22(13)11-1-3-20-14(17)8-11;2-1-3/h1-8,15H;.
What are the key properties of carbon dioxide;2-chloro-4-[5-[3-chloro-5-(difluoromethoxy)phenyl]pyrazol-1-yl]pyridine?
carbon dioxide;2-chloro-4-[5-[3-chloro-5-(difluoromethoxy)phenyl]pyrazol-1-yl]pyridine has a molecular weight of 400.17 g/mol, XLogP of 4.26, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;2-chloro-4-[5-[3-chloro-5-(difluoromethoxy)phenyl]pyrazol-1-yl]pyridine is sourced from PubChem (CID 157368984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).