About ethyl 5-hydrazinyl-1,3-thiazole-4-carboxylate
ethyl 5-hydrazinyl-1,3-thiazole-4-carboxylate (PubChem CID 157368989) has the molecular formula C12H18N6O4S2
and a molecular weight of 374.45 g/mol. Its IUPAC name is ethyl 5-hydrazinyl-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-hydrazinyl-1,3-thiazole-4-carboxylate |
| PubChem CID | 157368989 |
| Molecular Formula | C12H18N6O4S2 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | ethyl 5-hydrazinyl-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1ncsc1NN.CCOC(=O)c1ncsc1NN |
| InChI | InChI=1S/2C6H9N3O2S/c2*1-2-11-6(10)4-5(9-7)12-3-8-4/h2*3,9H,2,7H2,1H3 |
| InChIKey | BJNJEYVFUXUGGI-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 154.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-hydrazinyl-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-hydrazinyl-1,3-thiazole-4-carboxylate?
The IUPAC name of ethyl 5-hydrazinyl-1,3-thiazole-4-carboxylate (CID 157368989) is ethyl 5-hydrazinyl-1,3-thiazole-4-carboxylate.
What is the SMILES notation for ethyl 5-hydrazinyl-1,3-thiazole-4-carboxylate?
The canonical SMILES for ethyl 5-hydrazinyl-1,3-thiazole-4-carboxylate is CCOC(=O)c1ncsc1NN.CCOC(=O)c1ncsc1NN.
What is the InChIKey of ethyl 5-hydrazinyl-1,3-thiazole-4-carboxylate?
The InChIKey is BJNJEYVFUXUGGI-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H9N3O2S/c2*1-2-11-6(10)4-5(9-7)12-3-8-4/h2*3,9H,2,7H2,1H3.
What are the key properties of ethyl 5-hydrazinyl-1,3-thiazole-4-carboxylate?
ethyl 5-hydrazinyl-1,3-thiazole-4-carboxylate has a molecular weight of 374.45 g/mol, XLogP of 1.21, 6 rotatable bonds, 4 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-hydrazinyl-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 157368989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).