About (5-tert-butyl-1,3-thiazol-2-yl)-methyl-methylidene-oxo-λ6-sulfane
(5-tert-butyl-1,3-thiazol-2-yl)-methyl-methylidene-oxo-λ6-sulfane (PubChem CID 157369566) has the molecular formula C9H15NOS2
and a molecular weight of 217.36 g/mol. Its IUPAC name is (5-tert-butyl-1,3-thiazol-2-yl)-methyl-methylidene-oxo-λ6-sulfane.
Molecular Properties
| Compound Name | (5-tert-butyl-1,3-thiazol-2-yl)-methyl-methylidene-oxo-λ6-sulfane |
| PubChem CID | 157369566 |
| Molecular Formula | C9H15NOS2 |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | (5-tert-butyl-1,3-thiazol-2-yl)-methyl-methylidene-oxo-λ6-sulfane |
| SMILES | C=S(C)(=O)c1ncc(C(C)(C)C)s1 |
| InChI | InChI=1S/C9H15NOS2/c1-9(2,3)7-6-10-8(12-7)13(4,5)11/h6H,4H2,1-3,5H3 |
| InChIKey | QYTPBPIHVOTEEI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (5-tert-butyl-1,3-thiazol-2-yl)-methyl-methylidene-oxo-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-tert-butyl-1,3-thiazol-2-yl)-methyl-methylidene-oxo-λ6-sulfane?
The IUPAC name of (5-tert-butyl-1,3-thiazol-2-yl)-methyl-methylidene-oxo-λ6-sulfane (CID 157369566) is (5-tert-butyl-1,3-thiazol-2-yl)-methyl-methylidene-oxo-λ6-sulfane.
What is the SMILES notation for (5-tert-butyl-1,3-thiazol-2-yl)-methyl-methylidene-oxo-λ6-sulfane?
The canonical SMILES for (5-tert-butyl-1,3-thiazol-2-yl)-methyl-methylidene-oxo-λ6-sulfane is C=S(C)(=O)c1ncc(C(C)(C)C)s1.
What is the InChIKey of (5-tert-butyl-1,3-thiazol-2-yl)-methyl-methylidene-oxo-λ6-sulfane?
The InChIKey is QYTPBPIHVOTEEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NOS2/c1-9(2,3)7-6-10-8(12-7)13(4,5)11/h6H,4H2,1-3,5H3.
What are the key properties of (5-tert-butyl-1,3-thiazol-2-yl)-methyl-methylidene-oxo-λ6-sulfane?
(5-tert-butyl-1,3-thiazol-2-yl)-methyl-methylidene-oxo-λ6-sulfane has a molecular weight of 217.36 g/mol, XLogP of 2.15, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-tert-butyl-1,3-thiazol-2-yl)-methyl-methylidene-oxo-λ6-sulfane is sourced from PubChem (CID 157369566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).