About 4-(4-amino-6,7-dimethoxy-2-sulfanylidenequinazolin-3-yl)-1-(1H-indol-2-yl)butan-1-one
4-(4-amino-6,7-dimethoxy-2-sulfanylidenequinazolin-3-yl)-1-(1H-indol-2-yl)butan-1-one (PubChem CID 157369674) has the molecular formula C22H22N4O3S
and a molecular weight of 422.51 g/mol. Its IUPAC name is 4-(4-amino-6,7-dimethoxy-2-sulfanylidenequinazolin-3-yl)-1-(1H-indol-2-yl)butan-1-one.
Molecular Properties
| Compound Name | 4-(4-amino-6,7-dimethoxy-2-sulfanylidenequinazolin-3-yl)-1-(1H-indol-2-yl)butan-1-one |
| PubChem CID | 157369674 |
| Molecular Formula | C22H22N4O3S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 4-(4-amino-6,7-dimethoxy-2-sulfanylidenequinazolin-3-yl)-1-(1H-indol-2-yl)butan-1-one |
| SMILES | COc1cc2nc(=S)n(CCCC(=O)c3cc4ccccc4[nH]3)c(N)c2cc1OC |
| InChI | InChI=1S/C22H22N4O3S/c1-28-19-11-14-16(12-20(19)29-2)25-22(30)26(21(14)23)9-5-8-18(27)17-10-13-6-3-4-7-15(13)24-17/h3-4,6-7,10-12,24H,5,8-9,23H2,1-2H3 |
| InChIKey | MIWVXAACQHPJFH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-amino-6,7-dimethoxy-2-sulfanylidenequinazolin-3-yl)-1-(1H-indol-2-yl)butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-amino-6,7-dimethoxy-2-sulfanylidenequinazolin-3-yl)-1-(1H-indol-2-yl)butan-1-one?
The IUPAC name of 4-(4-amino-6,7-dimethoxy-2-sulfanylidenequinazolin-3-yl)-1-(1H-indol-2-yl)butan-1-one (CID 157369674) is 4-(4-amino-6,7-dimethoxy-2-sulfanylidenequinazolin-3-yl)-1-(1H-indol-2-yl)butan-1-one.
What is the SMILES notation for 4-(4-amino-6,7-dimethoxy-2-sulfanylidenequinazolin-3-yl)-1-(1H-indol-2-yl)butan-1-one?
The canonical SMILES for 4-(4-amino-6,7-dimethoxy-2-sulfanylidenequinazolin-3-yl)-1-(1H-indol-2-yl)butan-1-one is COc1cc2nc(=S)n(CCCC(=O)c3cc4ccccc4[nH]3)c(N)c2cc1OC.
What is the InChIKey of 4-(4-amino-6,7-dimethoxy-2-sulfanylidenequinazolin-3-yl)-1-(1H-indol-2-yl)butan-1-one?
The InChIKey is MIWVXAACQHPJFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N4O3S/c1-28-19-11-14-16(12-20(19)29-2)25-22(30)26(21(14)23)9-5-8-18(27)17-10-13-6-3-4-7-15(13)24-17/h3-4,6-7,10-12,24H,5,8-9,23H2,1-2H3.
What are the key properties of 4-(4-amino-6,7-dimethoxy-2-sulfanylidenequinazolin-3-yl)-1-(1H-indol-2-yl)butan-1-one?
4-(4-amino-6,7-dimethoxy-2-sulfanylidenequinazolin-3-yl)-1-(1H-indol-2-yl)butan-1-one has a molecular weight of 422.51 g/mol, XLogP of 4.51, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-amino-6,7-dimethoxy-2-sulfanylidenequinazolin-3-yl)-1-(1H-indol-2-yl)butan-1-one is sourced from PubChem (CID 157369674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).