C33H39F5O5S — CID 157370861
[(7R,8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-7-[3-(4,4,5,5,5-pentafluoropentylsulfinyl)propyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 2-hydroxybenzoate (PubChem CID 157370861) has the molecular formula C33H39F5O5S and a molecular weight of 642.73 g/mol. Its IUPAC name is [(7R,8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-7-[3-(4,4,5,5,5-pentafluoropentylsulfinyl)propyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 2-hydroxybenzoate.
| Compound Name | [(7R,8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-7-[3-(4,4,5,5,5-pentafluoropentylsulfinyl)propyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 2-hydroxybenzoate |
|---|---|
| PubChem CID | 157370861 |
| Molecular Formula | C33H39F5O5S |
| Molecular Weight | 642.73 g/mol |
| Exact Mass | 642.24 |
| IUPAC Name | [(7R,8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-7-[3-(4,4,5,5,5-pentafluoropentylsulfinyl)propyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] 2-hydroxybenzoate |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OC(=O)c5ccccc5O)cc4C[C@@H](CCCS(=O)CCCC(F)(F)C(F)(F)F)[C@H]3[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C33H39F5O5S/c1-31-15-13-24-23-10-9-22(43-30(41)25-7-2-3-8-27(25)39)19-21(23)18-20(29(24)26(31)11-12-28(31)40)6-4-16-44(42)17-5-14-32(34,35)33(36,37)38/h2-3,7-10,19-20,24,26,28-29,39-40H,4-6,11-18H2,1H3/t20-,24-,26+,28+,29-,31+,44?/m1/s1 |
| InChIKey | GXRXJFZMBYPMGY-CYHNEUQPSA-N |
| XLogP | 7.56 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.73 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|