C25H32Br2O3 — CID 157371082
1,3-bis(bromomethyl)benzene;1,3-bis(prop-2-enoxymethyl)benzene;prop-2-en-1-ol (PubChem CID 157371082) has the molecular formula C25H32Br2O3 and a molecular weight of 540.34 g/mol. Its IUPAC name is 1,3-bis(bromomethyl)benzene;1,3-bis(prop-2-enoxymethyl)benzene;prop-2-en-1-ol.
| Compound Name | 1,3-bis(bromomethyl)benzene;1,3-bis(prop-2-enoxymethyl)benzene;prop-2-en-1-ol |
|---|---|
| PubChem CID | 157371082 |
| Molecular Formula | C25H32Br2O3 |
| Molecular Weight | 540.34 g/mol |
| Exact Mass | 538.07 |
| IUPAC Name | 1,3-bis(bromomethyl)benzene;1,3-bis(prop-2-enoxymethyl)benzene;prop-2-en-1-ol |
| SMILES | BrCc1cccc(CBr)c1.C=CCO.C=CCOCc1cccc(COCC=C)c1 |
| InChI | InChI=1S/C14H18O2.C8H8Br2.C3H6O/c1-3-8-15-11-13-6-5-7-14(10-13)12-16-9-4-2;9-5-7-2-1-3-8(4-7)6-10;1-2-3-4/h3-7,10H,1-2,8-9,11-12H2;1-4H,5-6H2;2,4H,1,3H2 |
| InChIKey | BJTRLGMEFQDTLJ-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.34 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|