About tert-butyl 3-iodoindazole-1-carboxylate;3-iodo-2H-indazole;methane
tert-butyl 3-iodoindazole-1-carboxylate;3-iodo-2H-indazole;methane (PubChem CID 157371394) has the molecular formula C20H22I2N4O2
and a molecular weight of 604.23 g/mol. Its IUPAC name is tert-butyl 3-iodoindazole-1-carboxylate;3-iodo-2H-indazole;methane.
Molecular Properties
| Compound Name | tert-butyl 3-iodoindazole-1-carboxylate;3-iodo-2H-indazole;methane |
| PubChem CID | 157371394 |
| Molecular Formula | C20H22I2N4O2 |
| Molecular Weight | 604.23 g/mol |
| Exact Mass | 603.98 |
| IUPAC Name | tert-butyl 3-iodoindazole-1-carboxylate;3-iodo-2H-indazole;methane |
| SMILES | C.CC(C)(C)OC(=O)n1nc(I)c2ccccc21.Ic1[nH]nc2ccccc12 |
| InChI | InChI=1S/C12H13IN2O2.C7H5IN2.CH4/c1-12(2,3)17-11(16)15-9-7-5-4-6-8(9)10(13)14-15;8-7-5-3-1-2-4-6(5)9-10-7;/h4-7H,1-3H3;1-4H,(H,9,10);1H4 |
| InChIKey | BJUPSESRYSMNIR-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 604.23 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3-iodoindazole-1-carboxylate;3-iodo-2H-indazole;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-iodoindazole-1-carboxylate;3-iodo-2H-indazole;methane?
The IUPAC name of tert-butyl 3-iodoindazole-1-carboxylate;3-iodo-2H-indazole;methane (CID 157371394) is tert-butyl 3-iodoindazole-1-carboxylate;3-iodo-2H-indazole;methane.
What is the SMILES notation for tert-butyl 3-iodoindazole-1-carboxylate;3-iodo-2H-indazole;methane?
The canonical SMILES for tert-butyl 3-iodoindazole-1-carboxylate;3-iodo-2H-indazole;methane is C.CC(C)(C)OC(=O)n1nc(I)c2ccccc21.Ic1[nH]nc2ccccc12.
What is the InChIKey of tert-butyl 3-iodoindazole-1-carboxylate;3-iodo-2H-indazole;methane?
The InChIKey is BJUPSESRYSMNIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13IN2O2.C7H5IN2.CH4/c1-12(2,3)17-11(16)15-9-7-5-4-6-8(9)10(13)14-15;8-7-5-3-1-2-4-6(5)9-10-7;/h4-7H,1-3H3;1-4H,(H,9,10);1H4.
What are the key properties of tert-butyl 3-iodoindazole-1-carboxylate;3-iodo-2H-indazole;methane?
tert-butyl 3-iodoindazole-1-carboxylate;3-iodo-2H-indazole;methane has a molecular weight of 604.23 g/mol, XLogP of 6.23, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-iodoindazole-1-carboxylate;3-iodo-2H-indazole;methane is sourced from PubChem (CID 157371394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).