About 4-propan-2-yloxane;3-propan-2-yloxolane
4-propan-2-yloxane;3-propan-2-yloxolane (PubChem CID 157371501) has the molecular formula C15H30O2
and a molecular weight of 242.40 g/mol. Its IUPAC name is 4-propan-2-yloxane;3-propan-2-yloxolane.
Molecular Properties
| Compound Name | 4-propan-2-yloxane;3-propan-2-yloxolane |
| PubChem CID | 157371501 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | 4-propan-2-yloxane;3-propan-2-yloxolane |
| SMILES | CC(C)C1CCOC1.CC(C)C1CCOCC1 |
| InChI | InChI=1S/C8H16O.C7H14O/c1-7(2)8-3-5-9-6-4-8;1-6(2)7-3-4-8-5-7/h7-8H,3-6H2,1-2H3;6-7H,3-5H2,1-2H3 |
| InChIKey | BJUWZOFGOFBPEE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-propan-2-yloxane;3-propan-2-yloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yloxane;3-propan-2-yloxolane?
The IUPAC name of 4-propan-2-yloxane;3-propan-2-yloxolane (CID 157371501) is 4-propan-2-yloxane;3-propan-2-yloxolane.
What is the SMILES notation for 4-propan-2-yloxane;3-propan-2-yloxolane?
The canonical SMILES for 4-propan-2-yloxane;3-propan-2-yloxolane is CC(C)C1CCOC1.CC(C)C1CCOCC1.
What is the InChIKey of 4-propan-2-yloxane;3-propan-2-yloxolane?
The InChIKey is BJUWZOFGOFBPEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O.C7H14O/c1-7(2)8-3-5-9-6-4-8;1-6(2)7-3-4-8-5-7/h7-8H,3-6H2,1-2H3;6-7H,3-5H2,1-2H3.
What are the key properties of 4-propan-2-yloxane;3-propan-2-yloxolane?
4-propan-2-yloxane;3-propan-2-yloxolane has a molecular weight of 242.40 g/mol, XLogP of 3.75, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yloxane;3-propan-2-yloxolane is sourced from PubChem (CID 157371501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).