About 6-chloro-4-fluoro-9,10-dimethoxy-[1]benzothiolo[2,3-c]quinoline
6-chloro-4-fluoro-9,10-dimethoxy-[1]benzothiolo[2,3-c]quinoline (PubChem CID 15737169) has the molecular formula C17H11ClFNO2S
and a molecular weight of 347.80 g/mol. Its IUPAC name is 6-chloro-4-fluoro-9,10-dimethoxy-[1]benzothiolo[2,3-c]quinoline.
Molecular Properties
| Compound Name | 6-chloro-4-fluoro-9,10-dimethoxy-[1]benzothiolo[2,3-c]quinoline |
| PubChem CID | 15737169 |
| Molecular Formula | C17H11ClFNO2S |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 6-chloro-4-fluoro-9,10-dimethoxy-[1]benzothiolo[2,3-c]quinoline |
| SMILES | COc1cc2sc3c(Cl)nc4c(F)cccc4c3c2cc1OC |
| InChI | InChI=1S/C17H11ClFNO2S/c1-21-11-6-9-13(7-12(11)22-2)23-16-14(9)8-4-3-5-10(19)15(8)20-17(16)18/h3-7H,1-2H3 |
| InChIKey | JYEBGJJSKDVPIU-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-4-fluoro-9,10-dimethoxy-[1]benzothiolo[2,3-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-4-fluoro-9,10-dimethoxy-[1]benzothiolo[2,3-c]quinoline?
The IUPAC name of 6-chloro-4-fluoro-9,10-dimethoxy-[1]benzothiolo[2,3-c]quinoline (CID 15737169) is 6-chloro-4-fluoro-9,10-dimethoxy-[1]benzothiolo[2,3-c]quinoline.
What is the SMILES notation for 6-chloro-4-fluoro-9,10-dimethoxy-[1]benzothiolo[2,3-c]quinoline?
The canonical SMILES for 6-chloro-4-fluoro-9,10-dimethoxy-[1]benzothiolo[2,3-c]quinoline is COc1cc2sc3c(Cl)nc4c(F)cccc4c3c2cc1OC.
What is the InChIKey of 6-chloro-4-fluoro-9,10-dimethoxy-[1]benzothiolo[2,3-c]quinoline?
The InChIKey is JYEBGJJSKDVPIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11ClFNO2S/c1-21-11-6-9-13(7-12(11)22-2)23-16-14(9)8-4-3-5-10(19)15(8)20-17(16)18/h3-7H,1-2H3.
What are the key properties of 6-chloro-4-fluoro-9,10-dimethoxy-[1]benzothiolo[2,3-c]quinoline?
6-chloro-4-fluoro-9,10-dimethoxy-[1]benzothiolo[2,3-c]quinoline has a molecular weight of 347.80 g/mol, XLogP of 5.41, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-4-fluoro-9,10-dimethoxy-[1]benzothiolo[2,3-c]quinoline is sourced from PubChem (CID 15737169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).