About 1H-benzimidazole;oxolane
1H-benzimidazole;oxolane (PubChem CID 157372147) has the molecular formula C11H14N2O
and a molecular weight of 190.25 g/mol. Its IUPAC name is 1H-benzimidazole;oxolane.
Molecular Properties
| Compound Name | 1H-benzimidazole;oxolane |
| PubChem CID | 157372147 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 1H-benzimidazole;oxolane |
| SMILES | C1CCOC1.c1ccc2[nH]cnc2c1 |
| InChI | InChI=1S/C7H6N2.C4H8O/c1-2-4-7-6(3-1)8-5-9-7;1-2-4-5-3-1/h1-5H,(H,8,9);1-4H2 |
| InChIKey | BJWUOUVQSUJAOH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-benzimidazole;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzimidazole;oxolane?
The IUPAC name of 1H-benzimidazole;oxolane (CID 157372147) is 1H-benzimidazole;oxolane.
What is the SMILES notation for 1H-benzimidazole;oxolane?
The canonical SMILES for 1H-benzimidazole;oxolane is C1CCOC1.c1ccc2[nH]cnc2c1.
What is the InChIKey of 1H-benzimidazole;oxolane?
The InChIKey is BJWUOUVQSUJAOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.C4H8O/c1-2-4-7-6(3-1)8-5-9-7;1-2-4-5-3-1/h1-5H,(H,8,9);1-4H2.
What are the key properties of 1H-benzimidazole;oxolane?
1H-benzimidazole;oxolane has a molecular weight of 190.25 g/mol, XLogP of 2.36, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzimidazole;oxolane is sourced from PubChem (CID 157372147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).