About 2,4-dimethylpent-2-ene;N-propan-2-ylpropan-2-imine
2,4-dimethylpent-2-ene;N-propan-2-ylpropan-2-imine (PubChem CID 157372202) has the molecular formula C13H27N
and a molecular weight of 197.37 g/mol. Its IUPAC name is 2,4-dimethylpent-2-ene;N-propan-2-ylpropan-2-imine.
Molecular Properties
| Compound Name | 2,4-dimethylpent-2-ene;N-propan-2-ylpropan-2-imine |
| PubChem CID | 157372202 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | 2,4-dimethylpent-2-ene;N-propan-2-ylpropan-2-imine |
| SMILES | CC(C)=CC(C)C.CC(C)=NC(C)C |
| InChI | InChI=1S/C7H14.C6H13N/c1-6(2)5-7(3)4;1-5(2)7-6(3)4/h5-6H,1-4H3;5H,1-4H3 |
| InChIKey | BJWYEURPJZTCSF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethylpent-2-ene;N-propan-2-ylpropan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylpent-2-ene;N-propan-2-ylpropan-2-imine?
The IUPAC name of 2,4-dimethylpent-2-ene;N-propan-2-ylpropan-2-imine (CID 157372202) is 2,4-dimethylpent-2-ene;N-propan-2-ylpropan-2-imine.
What is the SMILES notation for 2,4-dimethylpent-2-ene;N-propan-2-ylpropan-2-imine?
The canonical SMILES for 2,4-dimethylpent-2-ene;N-propan-2-ylpropan-2-imine is CC(C)=CC(C)C.CC(C)=NC(C)C.
What is the InChIKey of 2,4-dimethylpent-2-ene;N-propan-2-ylpropan-2-imine?
The InChIKey is BJWYEURPJZTCSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14.C6H13N/c1-6(2)5-7(3)4;1-5(2)7-6(3)4/h5-6H,1-4H3;5H,1-4H3.
What are the key properties of 2,4-dimethylpent-2-ene;N-propan-2-ylpropan-2-imine?
2,4-dimethylpent-2-ene;N-propan-2-ylpropan-2-imine has a molecular weight of 197.37 g/mol, XLogP of 4.48, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylpent-2-ene;N-propan-2-ylpropan-2-imine is sourced from PubChem (CID 157372202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).