C15H18O5 — CID 15737288
(1R,2S,5R,6S,9R,11S)-5,9,14-trimethyl-3,12,13-trioxatetracyclo[9.2.2.01,9.02,6]pentadec-14-ene-4,10-dione (PubChem CID 15737288) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is (1R,2S,5R,6S,9R,11S)-5,9,14-trimethyl-3,12,13-trioxatetracyclo[9.2.2.01,9.02,6]pentadec-14-ene-4,10-dione.
| Compound Name | (1R,2S,5R,6S,9R,11S)-5,9,14-trimethyl-3,12,13-trioxatetracyclo[9.2.2.01,9.02,6]pentadec-14-ene-4,10-dione |
|---|---|
| PubChem CID | 15737288 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | (1R,2S,5R,6S,9R,11S)-5,9,14-trimethyl-3,12,13-trioxatetracyclo[9.2.2.01,9.02,6]pentadec-14-ene-4,10-dione |
| SMILES | CC1=C[C@@H]2OO[C@]13[C@H]1OC(=O)[C@H](C)[C@@H]1CC[C@@]3(C)C2=O |
| InChI | InChI=1S/C15H18O5/c1-7-6-10-11(16)14(3)5-4-9-8(2)13(17)18-12(9)15(7,14)20-19-10/h6,8-10,12H,4-5H2,1-3H3/t8-,9+,10+,12+,14+,15+/m1/s1 |
| InChIKey | VHVVJOAHGVSMII-CXCXHPLRSA-N |
| XLogP | 1.56 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|