C18H34O5P2 — CID 15737300
[hydroxy(methoxy)phosphoryl]methyl-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]phosphinic acid (PubChem CID 15737300) has the molecular formula C18H34O5P2 and a molecular weight of 392.41 g/mol. Its IUPAC name is [hydroxy(methoxy)phosphoryl]methyl-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]phosphinic acid.
| Compound Name | [hydroxy(methoxy)phosphoryl]methyl-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]phosphinic acid |
|---|---|
| PubChem CID | 15737300 |
| Molecular Formula | C18H34O5P2 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | [hydroxy(methoxy)phosphoryl]methyl-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]phosphinic acid |
| SMILES | COP(=O)(O)CP(=O)(O)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C18H34O5P2/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-24(19,20)15-25(21,22)23-5/h9,11,13H,6-8,10,12,14-15H2,1-5H3,(H,19,20)(H,21,22)/b17-11+,18-13+ |
| InChIKey | QSWYHRJTJVCMKY-OUBUNXTGSA-N |
| XLogP | 5.86 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|