C15H25BrN2O2 — CID 157374545
5-bromo-N,N-diethyl-2-hydroxybenzamide;N-ethylethanamine (PubChem CID 157374545) has the molecular formula C15H25BrN2O2 and a molecular weight of 345.28 g/mol. Its IUPAC name is 5-bromo-N,N-diethyl-2-hydroxybenzamide;N-ethylethanamine.
| Compound Name | 5-bromo-N,N-diethyl-2-hydroxybenzamide;N-ethylethanamine |
|---|---|
| PubChem CID | 157374545 |
| Molecular Formula | C15H25BrN2O2 |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 5-bromo-N,N-diethyl-2-hydroxybenzamide;N-ethylethanamine |
| SMILES | CCN(CC)C(=O)c1cc(Br)ccc1O.CCNCC |
| InChI | InChI=1S/C11H14BrNO2.C4H11N/c1-3-13(4-2)11(15)9-7-8(12)5-6-10(9)14;1-3-5-4-2/h5-7,14H,3-4H2,1-2H3;5H,3-4H2,1-2H3 |
| InChIKey | BKDXYUHORSOHIC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |