C40H78N8 — CID 157375415
2,6-diethyl-1,2,3,4,6-pentamethylpiperidine;2-N,4-N,6-trimethyl-2-N,4-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 157375415) has the molecular formula C40H78N8 and a molecular weight of 671.12 g/mol. Its IUPAC name is 2,6-diethyl-1,2,3,4,6-pentamethylpiperidine;2-N,4-N,6-trimethyl-2-N,4-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2,6-diethyl-1,2,3,4,6-pentamethylpiperidine;2-N,4-N,6-trimethyl-2-N,4-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 157375415 |
| Molecular Formula | C40H78N8 |
| Molecular Weight | 671.12 g/mol |
| Exact Mass | 670.63 |
| IUPAC Name | 2,6-diethyl-1,2,3,4,6-pentamethylpiperidine;2-N,4-N,6-trimethyl-2-N,4-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCC1(C)CC(C)C(C)C(C)(CC)N1C.Cc1nc(N(C)C2CC(C)(C)N(C)C(C)(C)C2)nc(N(C)C2CC(C)(C)N(C)C(C)(C)C2)n1 |
| InChI | InChI=1S/C26H49N7.C14H29N/c1-18-27-21(30(10)19-14-23(2,3)32(12)24(4,5)15-19)29-22(28-18)31(11)20-16-25(6,7)33(13)26(8,9)17-20;1-8-13(5)10-11(3)12(4)14(6,9-2)15(13)7/h19-20H,14-17H2,1-13H3;11-12H,8-10H2,1-7H3 |
| InChIKey | BKGRKQFEVBSOCJ-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 54.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.12 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |