C16H20F3NO2 — CID 15737560
2,2,2-trifluoro-N-[(1R,2R)-1-[(2R)-pent-4-en-2-yl]oxy-1-phenylpropan-2-yl]acetamide (PubChem CID 15737560) has the molecular formula C16H20F3NO2 and a molecular weight of 315.34 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(1R,2R)-1-[(2R)-pent-4-en-2-yl]oxy-1-phenylpropan-2-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(1R,2R)-1-[(2R)-pent-4-en-2-yl]oxy-1-phenylpropan-2-yl]acetamide |
|---|---|
| PubChem CID | 15737560 |
| Molecular Formula | C16H20F3NO2 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 2,2,2-trifluoro-N-[(1R,2R)-1-[(2R)-pent-4-en-2-yl]oxy-1-phenylpropan-2-yl]acetamide |
| SMILES | C=CC[C@@H](C)O[C@H](c1ccccc1)[C@@H](C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C16H20F3NO2/c1-4-8-11(2)22-14(13-9-6-5-7-10-13)12(3)20-15(21)16(17,18)19/h4-7,9-12,14H,1,8H2,2-3H3,(H,20,21)/t11-,12-,14+/m1/s1 |
| InChIKey | QBXVACXPOPMNSD-BZPMIXESSA-N |
| XLogP | 3.78 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|