C17H22F3NO2 — CID 15737561
2,2,2-trifluoro-N-[(1R,2R)-1-[(3R)-hex-5-en-3-yl]oxy-1-phenylpropan-2-yl]acetamide (PubChem CID 15737561) has the molecular formula C17H22F3NO2 and a molecular weight of 329.36 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(1R,2R)-1-[(3R)-hex-5-en-3-yl]oxy-1-phenylpropan-2-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(1R,2R)-1-[(3R)-hex-5-en-3-yl]oxy-1-phenylpropan-2-yl]acetamide |
|---|---|
| PubChem CID | 15737561 |
| Molecular Formula | C17H22F3NO2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 2,2,2-trifluoro-N-[(1R,2R)-1-[(3R)-hex-5-en-3-yl]oxy-1-phenylpropan-2-yl]acetamide |
| SMILES | C=CC[C@@H](CC)O[C@H](c1ccccc1)[C@@H](C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C17H22F3NO2/c1-4-9-14(5-2)23-15(13-10-7-6-8-11-13)12(3)21-16(22)17(18,19)20/h4,6-8,10-12,14-15H,1,5,9H2,2-3H3,(H,21,22)/t12-,14-,15+/m1/s1 |
| InChIKey | PQJKWIONBRIRKK-YUELXQCFSA-N |
| XLogP | 4.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|