C23H24F3NO2 — CID 15737565
2,2,2-trifluoro-N-[(1R,2R)-1-phenyl-1-[(1E,3S)-1-phenylhexa-1,5-dien-3-yl]oxypropan-2-yl]acetamide (PubChem CID 15737565) has the molecular formula C23H24F3NO2 and a molecular weight of 403.44 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(1R,2R)-1-phenyl-1-[(1E,3S)-1-phenylhexa-1,5-dien-3-yl]oxypropan-2-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(1R,2R)-1-phenyl-1-[(1E,3S)-1-phenylhexa-1,5-dien-3-yl]oxypropan-2-yl]acetamide |
|---|---|
| PubChem CID | 15737565 |
| Molecular Formula | C23H24F3NO2 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 2,2,2-trifluoro-N-[(1R,2R)-1-phenyl-1-[(1E,3S)-1-phenylhexa-1,5-dien-3-yl]oxypropan-2-yl]acetamide |
| SMILES | C=CC[C@@H](/C=C/c1ccccc1)O[C@H](c1ccccc1)[C@@H](C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C23H24F3NO2/c1-3-10-20(16-15-18-11-6-4-7-12-18)29-21(19-13-8-5-9-14-19)17(2)27-22(28)23(24,25)26/h3-9,11-17,20-21H,1,10H2,2H3,(H,27,28)/b16-15+/t17-,20+,21+/m1/s1 |
| InChIKey | AHQFPDSMVUYTCL-ZDCIOYLDSA-N |
| XLogP | 5.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|