C21H22F3NO2 — CID 15737566
2,2,2-trifluoro-N-[(1R,2R)-1-phenyl-1-[(1S)-1-phenylbut-3-enoxy]propan-2-yl]acetamide (PubChem CID 15737566) has the molecular formula C21H22F3NO2 and a molecular weight of 377.41 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(1R,2R)-1-phenyl-1-[(1S)-1-phenylbut-3-enoxy]propan-2-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(1R,2R)-1-phenyl-1-[(1S)-1-phenylbut-3-enoxy]propan-2-yl]acetamide |
|---|---|
| PubChem CID | 15737566 |
| Molecular Formula | C21H22F3NO2 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 2,2,2-trifluoro-N-[(1R,2R)-1-phenyl-1-[(1S)-1-phenylbut-3-enoxy]propan-2-yl]acetamide |
| SMILES | C=CC[C@H](O[C@H](c1ccccc1)[C@@H](C)NC(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C21H22F3NO2/c1-3-10-18(16-11-6-4-7-12-16)27-19(17-13-8-5-9-14-17)15(2)25-20(26)21(22,23)24/h3-9,11-15,18-19H,1,10H2,2H3,(H,25,26)/t15-,18+,19+/m1/s1 |
| InChIKey | QLNQKULKIMFNPF-MNEFBYGVSA-N |
| XLogP | 5.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|