C14H27NO3S — CID 157376058
methane;methanesulfonate;1,2,3,3-tetramethyl-4,5,6,7-tetrahydroindol-1-ium (PubChem CID 157376058) has the molecular formula C14H27NO3S and a molecular weight of 289.44 g/mol. Its IUPAC name is methane;methanesulfonate;1,2,3,3-tetramethyl-4,5,6,7-tetrahydroindol-1-ium.
| Compound Name | methane;methanesulfonate;1,2,3,3-tetramethyl-4,5,6,7-tetrahydroindol-1-ium |
|---|---|
| PubChem CID | 157376058 |
| Molecular Formula | C14H27NO3S |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | methane;methanesulfonate;1,2,3,3-tetramethyl-4,5,6,7-tetrahydroindol-1-ium |
| SMILES | C.CC1=[N+](C)C2=C(CCCC2)C1(C)C.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C12H20N.CH4O3S.CH4/c1-9-12(2,3)10-7-5-6-8-11(10)13(9)4;1-5(2,3)4;/h5-8H2,1-4H3;1H3,(H,2,3,4);1H4/q+1;;/p-1 |
| InChIKey | ZGHYNGHHIHCWGL-UHFFFAOYSA-M |
| XLogP | 2.76 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|