C19H14F4I2O5 — CID 157376548
[4-(hydroxymethyl)-2,6-diiodophenyl] 4-(2,2,3,3-tetrafluorobutanoyloxymethyl)benzoate (PubChem CID 157376548) has the molecular formula C19H14F4I2O5 and a molecular weight of 652.12 g/mol. Its IUPAC name is [4-(hydroxymethyl)-2,6-diiodophenyl] 4-(2,2,3,3-tetrafluorobutanoyloxymethyl)benzoate.
| Compound Name | [4-(hydroxymethyl)-2,6-diiodophenyl] 4-(2,2,3,3-tetrafluorobutanoyloxymethyl)benzoate |
|---|---|
| PubChem CID | 157376548 |
| Molecular Formula | C19H14F4I2O5 |
| Molecular Weight | 652.12 g/mol |
| Exact Mass | 651.89 |
| IUPAC Name | [4-(hydroxymethyl)-2,6-diiodophenyl] 4-(2,2,3,3-tetrafluorobutanoyloxymethyl)benzoate |
| SMILES | CC(F)(F)C(F)(F)C(=O)OCc1ccc(C(=O)Oc2c(I)cc(CO)cc2I)cc1 |
| InChI | InChI=1S/C19H14F4I2O5/c1-18(20,21)19(22,23)17(28)29-9-10-2-4-12(5-3-10)16(27)30-15-13(24)6-11(8-26)7-14(15)25/h2-7,26H,8-9H2,1H3 |
| InChIKey | GRXRNMSKIUBLHN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.12 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|