C17H22O5 — CID 157376843
ethyl (3aS,5aR,9aR)-3a-hydroxy-2-oxo-5-prop-1-en-2-yl-3,4,5,5a,6,9-hexahydroindeno[7a,1-b]furan-3-carboxylate (PubChem CID 157376843) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is ethyl (3aS,5aR,9aR)-3a-hydroxy-2-oxo-5-prop-1-en-2-yl-3,4,5,5a,6,9-hexahydroindeno[7a,1-b]furan-3-carboxylate.
| Compound Name | ethyl (3aS,5aR,9aR)-3a-hydroxy-2-oxo-5-prop-1-en-2-yl-3,4,5,5a,6,9-hexahydroindeno[7a,1-b]furan-3-carboxylate |
|---|---|
| PubChem CID | 157376843 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | ethyl (3aS,5aR,9aR)-3a-hydroxy-2-oxo-5-prop-1-en-2-yl-3,4,5,5a,6,9-hexahydroindeno[7a,1-b]furan-3-carboxylate |
| SMILES | C=C(C)C1C[C@]2(O)C(C(=O)OCC)C(=O)O[C@@]23CC=CC[C@H]13 |
| InChI | InChI=1S/C17H22O5/c1-4-21-14(18)13-15(19)22-17-8-6-5-7-12(17)11(10(2)3)9-16(13,17)20/h5-6,11-13,20H,2,4,7-9H2,1,3H3/t11?,12-,13?,16+,17-/m1/s1 |
| InChIKey | BKKPJZXVKABNPG-OEGYUGMDSA-N |
| XLogP | 1.75 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|