C11H16N2O — CID 157377001
2-ethoxy-6,7,8,9-tetrahydro-5H-pyrido[2,3-d]azepine (PubChem CID 157377001) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-ethoxy-6,7,8,9-tetrahydro-5H-pyrido[2,3-d]azepine.
| Compound Name | 2-ethoxy-6,7,8,9-tetrahydro-5H-pyrido[2,3-d]azepine |
|---|---|
| PubChem CID | 157377001 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 2-ethoxy-6,7,8,9-tetrahydro-5H-pyrido[2,3-d]azepine |
| SMILES | CCOc1ccc2c(n1)CCNCC2 |
| InChI | InChI=1S/C11H16N2O/c1-2-14-11-4-3-9-5-7-12-8-6-10(9)13-11/h3-4,12H,2,5-8H2,1H3 |
| InChIKey | CCLQXZDHCCAUHQ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |