C23H23BrN4O2 — CID 157377791
N-(5-bromo-2-pyridinyl)-2-[2-[4-(N'-methylcarbamimidoyl)phenyl]-2-oxoethyl]benzamide;methane (PubChem CID 157377791) has the molecular formula C23H23BrN4O2 and a molecular weight of 467.37 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-2-[2-[4-(N'-methylcarbamimidoyl)phenyl]-2-oxoethyl]benzamide;methane.
| Compound Name | N-(5-bromo-2-pyridinyl)-2-[2-[4-(N'-methylcarbamimidoyl)phenyl]-2-oxoethyl]benzamide;methane |
|---|---|
| PubChem CID | 157377791 |
| Molecular Formula | C23H23BrN4O2 |
| Molecular Weight | 467.37 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-2-[2-[4-(N'-methylcarbamimidoyl)phenyl]-2-oxoethyl]benzamide;methane |
| SMILES | C.C/N=C(\N)c1ccc(C(=O)Cc2ccccc2C(=O)Nc2ccc(Br)cn2)cc1 |
| InChI | InChI=1S/C22H19BrN4O2.CH4/c1-25-21(24)15-8-6-14(7-9-15)19(28)12-16-4-2-3-5-18(16)22(29)27-20-11-10-17(23)13-26-20;/h2-11,13H,12H2,1H3,(H2,24,25)(H,26,27,29);1H4 |
| InChIKey | BKNBZVFHCRAWPA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 97.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.37 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|