About bis(cyclooctatetraene);nickel
bis(cyclooctatetraene);nickel (PubChem CID 15737790) has the molecular formula C16H16Ni
and a molecular weight of 267.00 g/mol. Its IUPAC name is bis(cyclooctatetraene);nickel.
Molecular Properties
| Compound Name | bis(cyclooctatetraene);nickel |
| PubChem CID | 15737790 |
| Molecular Formula | C16H16Ni |
| Molecular Weight | 267.00 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | bis(cyclooctatetraene);nickel |
| SMILES | C1=C\C=C/C=C\C=C/1.C1=C\C=C/C=C\C=C/1.[Ni] |
| InChI | InChI=1S/2C8H8.Ni/c2*1-2-4-6-8-7-5-3-1;/h2*1-8H;/b2*2-1-,3-1-,4-2-,5-3-,6-4-,7-5-,8-6-,8-7-; |
| InChIKey | BBWPNYFJSBTXCH-OGVMWVNQSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.00 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze bis(cyclooctatetraene);nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(cyclooctatetraene);nickel?
The IUPAC name of bis(cyclooctatetraene);nickel (CID 15737790) is bis(cyclooctatetraene);nickel.
What is the SMILES notation for bis(cyclooctatetraene);nickel?
The canonical SMILES for bis(cyclooctatetraene);nickel is C1=C\C=C/C=C\C=C/1.C1=C\C=C/C=C\C=C/1.[Ni].
What is the InChIKey of bis(cyclooctatetraene);nickel?
The InChIKey is BBWPNYFJSBTXCH-OGVMWVNQSA-N. The full InChI is InChI=1S/2C8H8.Ni/c2*1-2-4-6-8-7-5-3-1;/h2*1-8H;/b2*2-1-,3-1-,4-2-,5-3-,6-4-,7-5-,8-6-,8-7-;.
What are the key properties of bis(cyclooctatetraene);nickel?
bis(cyclooctatetraene);nickel has a molecular weight of 267.00 g/mol, XLogP of 4.45, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(cyclooctatetraene);nickel is sourced from PubChem (CID 15737790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).