About acetylene;2-methylidenebutanedioic acid;urea
acetylene;2-methylidenebutanedioic acid;urea (PubChem CID 157377951) has the molecular formula C8H12N2O5
and a molecular weight of 216.19 g/mol. Its IUPAC name is acetylene;2-methylidenebutanedioic acid;urea.
Molecular Properties
| Compound Name | acetylene;2-methylidenebutanedioic acid;urea |
| PubChem CID | 157377951 |
| Molecular Formula | C8H12N2O5 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | acetylene;2-methylidenebutanedioic acid;urea |
| SMILES | C#C.C=C(CC(=O)O)C(=O)O.NC(N)=O |
| InChI | InChI=1S/C5H6O4.C2H2.CH4N2O/c1-3(5(8)9)2-4(6)7;1-2;2-1(3)4/h1-2H2,(H,6,7)(H,8,9);1-2H;(H4,2,3,4) |
| InChIKey | BKNMBTAAFWVYGM-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 143.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;2-methylidenebutanedioic acid;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;2-methylidenebutanedioic acid;urea?
The IUPAC name of acetylene;2-methylidenebutanedioic acid;urea (CID 157377951) is acetylene;2-methylidenebutanedioic acid;urea.
What is the SMILES notation for acetylene;2-methylidenebutanedioic acid;urea?
The canonical SMILES for acetylene;2-methylidenebutanedioic acid;urea is C#C.C=C(CC(=O)O)C(=O)O.NC(N)=O.
What is the InChIKey of acetylene;2-methylidenebutanedioic acid;urea?
The InChIKey is BKNMBTAAFWVYGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O4.C2H2.CH4N2O/c1-3(5(8)9)2-4(6)7;1-2;2-1(3)4/h1-2H2,(H,6,7)(H,8,9);1-2H;(H4,2,3,4).
What are the key properties of acetylene;2-methylidenebutanedioic acid;urea?
acetylene;2-methylidenebutanedioic acid;urea has a molecular weight of 216.19 g/mol, XLogP of -0.62, 3 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;2-methylidenebutanedioic acid;urea is sourced from PubChem (CID 157377951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).