C22H28N8O3 — CID 157380036
N-[3-amino-4-(1-methoxypropan-2-ylamino)-1-methylimino-4-oxobut-2-en-2-yl]-6-cyclopropyl-3-(pyrimidin-5-ylamino)pyridine-2-carboxamide (PubChem CID 157380036) has the molecular formula C22H28N8O3 and a molecular weight of 452.52 g/mol. Its IUPAC name is N-[3-amino-4-(1-methoxypropan-2-ylamino)-1-methylimino-4-oxobut-2-en-2-yl]-6-cyclopropyl-3-(pyrimidin-5-ylamino)pyridine-2-carboxamide.
| Compound Name | N-[3-amino-4-(1-methoxypropan-2-ylamino)-1-methylimino-4-oxobut-2-en-2-yl]-6-cyclopropyl-3-(pyrimidin-5-ylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 157380036 |
| Molecular Formula | C22H28N8O3 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | N-[3-amino-4-(1-methoxypropan-2-ylamino)-1-methylimino-4-oxobut-2-en-2-yl]-6-cyclopropyl-3-(pyrimidin-5-ylamino)pyridine-2-carboxamide |
| SMILES | C/N=C/C(NC(=O)c1nc(C2CC2)ccc1Nc1cncnc1)=C(N)C(=O)NC(C)COC |
| InChI | InChI=1S/C22H28N8O3/c1-13(11-33-3)27-21(31)19(23)18(10-24-2)30-22(32)20-17(28-15-8-25-12-26-9-15)7-6-16(29-20)14-4-5-14/h6-10,12-14,28H,4-5,11,23H2,1-3H3,(H,27,31)(H,30,32)/b19-18?,24-10+ |
| InChIKey | BDRILAWUAYJZDO-RDGGTYSTSA-N |
| XLogP | 1.24 |
| TPSA | 156.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|