C27H30FN5O3 — CID 157380580
N-[3-[2-[4-[[(3S)-1-(2-fluoroethyl)pyrrolidin-3-yl]methyl]anilino]-5-methoxypyrimidin-4-yl]oxyphenyl]prop-2-enamide (PubChem CID 157380580) has the molecular formula C27H30FN5O3 and a molecular weight of 491.57 g/mol. Its IUPAC name is N-[3-[2-[4-[[(3S)-1-(2-fluoroethyl)pyrrolidin-3-yl]methyl]anilino]-5-methoxypyrimidin-4-yl]oxyphenyl]prop-2-enamide.
| Compound Name | N-[3-[2-[4-[[(3S)-1-(2-fluoroethyl)pyrrolidin-3-yl]methyl]anilino]-5-methoxypyrimidin-4-yl]oxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 157380580 |
| Molecular Formula | C27H30FN5O3 |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | N-[3-[2-[4-[[(3S)-1-(2-fluoroethyl)pyrrolidin-3-yl]methyl]anilino]-5-methoxypyrimidin-4-yl]oxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(C[C@H]4CCN(CCF)C4)cc3)ncc2OC)c1 |
| InChI | InChI=1S/C27H30FN5O3/c1-3-25(34)30-22-5-4-6-23(16-22)36-26-24(35-2)17-29-27(32-26)31-21-9-7-19(8-10-21)15-20-11-13-33(18-20)14-12-28/h3-10,16-17,20H,1,11-15,18H2,2H3,(H,30,34)(H,29,31,32)/t20-/m1/s1 |
| InChIKey | BKVJDJIONDNKCK-HXUWFJFHSA-N |
| XLogP | 4.98 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|