About (2,4-difluorophenyl)-(1,3-dimethylimidazol-1-ium-2-yl)diazene;methyl sulfate
(2,4-difluorophenyl)-(1,3-dimethylimidazol-1-ium-2-yl)diazene;methyl sulfate (PubChem CID 157382665) has the molecular formula C12H14F2N4O4S
and a molecular weight of 348.33 g/mol. Its IUPAC name is (2,4-difluorophenyl)-(1,3-dimethylimidazol-1-ium-2-yl)diazene;methyl sulfate.
Molecular Properties
| Compound Name | (2,4-difluorophenyl)-(1,3-dimethylimidazol-1-ium-2-yl)diazene;methyl sulfate |
| PubChem CID | 157382665 |
| Molecular Formula | C12H14F2N4O4S |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | (2,4-difluorophenyl)-(1,3-dimethylimidazol-1-ium-2-yl)diazene;methyl sulfate |
| SMILES | COS(=O)(=O)[O-].Cn1cc[n+](C)c1/N=N/c1ccc(F)cc1F |
| InChI | InChI=1S/C11H11F2N4.CH4O4S/c1-16-5-6-17(2)11(16)15-14-10-4-3-8(12)7-9(10)13;1-5-6(2,3)4/h3-7H,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | BLBJMEPITYPORY-UHFFFAOYSA-M |
| XLogP | 1.64 |
| TPSA | 99.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze (2,4-difluorophenyl)-(1,3-dimethylimidazol-1-ium-2-yl)diazene;methyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-difluorophenyl)-(1,3-dimethylimidazol-1-ium-2-yl)diazene;methyl sulfate?
The IUPAC name of (2,4-difluorophenyl)-(1,3-dimethylimidazol-1-ium-2-yl)diazene;methyl sulfate (CID 157382665) is (2,4-difluorophenyl)-(1,3-dimethylimidazol-1-ium-2-yl)diazene;methyl sulfate.
What is the SMILES notation for (2,4-difluorophenyl)-(1,3-dimethylimidazol-1-ium-2-yl)diazene;methyl sulfate?
The canonical SMILES for (2,4-difluorophenyl)-(1,3-dimethylimidazol-1-ium-2-yl)diazene;methyl sulfate is COS(=O)(=O)[O-].Cn1cc[n+](C)c1/N=N/c1ccc(F)cc1F.
What is the InChIKey of (2,4-difluorophenyl)-(1,3-dimethylimidazol-1-ium-2-yl)diazene;methyl sulfate?
The InChIKey is BLBJMEPITYPORY-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H11F2N4.CH4O4S/c1-16-5-6-17(2)11(16)15-14-10-4-3-8(12)7-9(10)13;1-5-6(2,3)4/h3-7H,1-2H3;1H3,(H,2,3,4)/q+1;/p-1.
What are the key properties of (2,4-difluorophenyl)-(1,3-dimethylimidazol-1-ium-2-yl)diazene;methyl sulfate?
(2,4-difluorophenyl)-(1,3-dimethylimidazol-1-ium-2-yl)diazene;methyl sulfate has a molecular weight of 348.33 g/mol, XLogP of 1.64, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-difluorophenyl)-(1,3-dimethylimidazol-1-ium-2-yl)diazene;methyl sulfate is sourced from PubChem (CID 157382665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).