C23H32F6N2O2S — CID 157383641
2-[[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]methyl]-5-[1,1,1,3,3,3-hexafluoro-2-[2-(1-methylpiperidin-4-yl)ethoxy]propan-2-yl]-5-methyl-1,3-thiazol-4-one (PubChem CID 157383641) has the molecular formula C23H32F6N2O2S and a molecular weight of 514.58 g/mol. Its IUPAC name is 2-[[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]methyl]-5-[1,1,1,3,3,3-hexafluoro-2-[2-(1-methylpiperidin-4-yl)ethoxy]propan-2-yl]-5-methyl-1,3-thiazol-4-one.
| Compound Name | 2-[[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]methyl]-5-[1,1,1,3,3,3-hexafluoro-2-[2-(1-methylpiperidin-4-yl)ethoxy]propan-2-yl]-5-methyl-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 157383641 |
| Molecular Formula | C23H32F6N2O2S |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | 2-[[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]methyl]-5-[1,1,1,3,3,3-hexafluoro-2-[2-(1-methylpiperidin-4-yl)ethoxy]propan-2-yl]-5-methyl-1,3-thiazol-4-one |
| SMILES | CN1CCC(CCOC(C(F)(F)F)(C(F)(F)F)C2(C)SC(C[C@H]3C[C@@H]4CC[C@H]3C4)=NC2=O)CC1 |
| InChI | InChI=1S/C23H32F6N2O2S/c1-20(19(32)30-18(34-20)13-17-12-15-3-4-16(17)11-15)21(22(24,25)26,23(27,28)29)33-10-7-14-5-8-31(2)9-6-14/h14-17H,3-13H2,1-2H3/t15-,16+,17-,20?/m1/s1 |
| InChIKey | BLEDUJYIUIHVDB-IWRZSDRUSA-N |
| XLogP | 5.86 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |