C12H15N3 — CID 157384473
(1S,3S,5S)-3-(5-ethynyl-1H-imidazol-2-yl)-6,6-dimethyl-2-azabicyclo[3.1.0]hexane (PubChem CID 157384473) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is (1S,3S,5S)-3-(5-ethynyl-1H-imidazol-2-yl)-6,6-dimethyl-2-azabicyclo[3.1.0]hexane.
| Compound Name | (1S,3S,5S)-3-(5-ethynyl-1H-imidazol-2-yl)-6,6-dimethyl-2-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 157384473 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | (1S,3S,5S)-3-(5-ethynyl-1H-imidazol-2-yl)-6,6-dimethyl-2-azabicyclo[3.1.0]hexane |
| SMILES | C#Cc1cnc([C@@H]2C[C@@H]3[C@H](N2)C3(C)C)[nH]1 |
| InChI | InChI=1S/C12H15N3/c1-4-7-6-13-11(14-7)9-5-8-10(15-9)12(8,2)3/h1,6,8-10,15H,5H2,2-3H3,(H,13,14)/t8-,9+,10+/m1/s1 |
| InChIKey | XOYJWDMVBUCSCP-UTLUCORTSA-N |
| XLogP | 1.45 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|