C19H22FeO — CID 157384980
cyclopenta-1,3-diene;cyclopenta-2,4-dien-1-ylidene-(2,2,3-trimethylcyclopent-3-en-1-yl)methanolate;iron(2+) (PubChem CID 157384980) has the molecular formula C19H22FeO and a molecular weight of 322.23 g/mol. Its IUPAC name is cyclopenta-1,3-diene;cyclopenta-2,4-dien-1-ylidene-(2,2,3-trimethylcyclopent-3-en-1-yl)methanolate;iron(2+).
| Compound Name | cyclopenta-1,3-diene;cyclopenta-2,4-dien-1-ylidene-(2,2,3-trimethylcyclopent-3-en-1-yl)methanolate;iron(2+) |
|---|---|
| PubChem CID | 157384980 |
| Molecular Formula | C19H22FeO |
| Molecular Weight | 322.23 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | cyclopenta-1,3-diene;cyclopenta-2,4-dien-1-ylidene-(2,2,3-trimethylcyclopent-3-en-1-yl)methanolate;iron(2+) |
| SMILES | CC1=CCC(C([O-])=C2C=CC=C2)C1(C)C.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C14H18O.C5H5.Fe/c1-10-8-9-12(14(10,2)3)13(15)11-6-4-5-7-11;1-2-4-5-3-1;/h4-8,12,15H,9H2,1-3H3;1-5H;/q;-1;+2/p-1 |
| InChIKey | AJKASXPIUGUVQD-UHFFFAOYSA-M |
| XLogP | 4.12 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.23 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|