C24H22ClFN2O — CID 157385283
2-(6-chloro-3-pyridinyl)-1-[(2S)-6-(6-fluoroquinolin-4-yl)spiro[2.5]octan-2-yl]ethanone (PubChem CID 157385283) has the molecular formula C24H22ClFN2O and a molecular weight of 408.90 g/mol. Its IUPAC name is 2-(6-chloro-3-pyridinyl)-1-[(2S)-6-(6-fluoroquinolin-4-yl)spiro[2.5]octan-2-yl]ethanone.
| Compound Name | 2-(6-chloro-3-pyridinyl)-1-[(2S)-6-(6-fluoroquinolin-4-yl)spiro[2.5]octan-2-yl]ethanone |
|---|---|
| PubChem CID | 157385283 |
| Molecular Formula | C24H22ClFN2O |
| Molecular Weight | 408.90 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 2-(6-chloro-3-pyridinyl)-1-[(2S)-6-(6-fluoroquinolin-4-yl)spiro[2.5]octan-2-yl]ethanone |
| SMILES | O=C(Cc1ccc(Cl)nc1)[C@H]1CC12CCC(c1ccnc3ccc(F)cc13)CC2 |
| InChI | InChI=1S/C24H22ClFN2O/c25-23-4-1-15(14-28-23)11-22(29)20-13-24(20)8-5-16(6-9-24)18-7-10-27-21-3-2-17(26)12-19(18)21/h1-4,7,10,12,14,16,20H,5-6,8-9,11,13H2/t16?,20-,24?/m1/s1 |
| InChIKey | ZFBVUWCSMNXLFV-HYSRAYMDSA-N |
| XLogP | 5.90 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.90 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|