C20H36O2 — CID 157385514
(5R)-2-methylidene-5-propan-2-ylcyclohexan-1-ol;(4R)-1-methyl-4-propan-2-yl-7-oxabicyclo[4.1.0]heptane (PubChem CID 157385514) has the molecular formula C20H36O2 and a molecular weight of 308.51 g/mol. Its IUPAC name is (5R)-2-methylidene-5-propan-2-ylcyclohexan-1-ol;(4R)-1-methyl-4-propan-2-yl-7-oxabicyclo[4.1.0]heptane.
| Compound Name | (5R)-2-methylidene-5-propan-2-ylcyclohexan-1-ol;(4R)-1-methyl-4-propan-2-yl-7-oxabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 157385514 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | (5R)-2-methylidene-5-propan-2-ylcyclohexan-1-ol;(4R)-1-methyl-4-propan-2-yl-7-oxabicyclo[4.1.0]heptane |
| SMILES | C=C1CC[C@@H](C(C)C)CC1O.CC(C)[C@@H]1CCC2(C)OC2C1 |
| InChI | InChI=1S/2C10H18O/c1-7(2)8-4-5-10(3)9(6-8)11-10;1-7(2)9-5-4-8(3)10(11)6-9/h7-9H,4-6H2,1-3H3;7,9-11H,3-6H2,1-2H3/t8-,9?,10?;9-,10?/m11/s1 |
| InChIKey | BLJPKXCRPBLVMP-HDBPMEQMSA-N |
| XLogP | 4.96 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|