C27H28ClF3N6 — CID 157385668
5-chloro-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene;5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene (PubChem CID 157385668) has the molecular formula C27H28ClF3N6 and a molecular weight of 529.01 g/mol. Its IUPAC name is 5-chloro-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene;5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene.
| Compound Name | 5-chloro-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene;5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene |
|---|---|
| PubChem CID | 157385668 |
| Molecular Formula | C27H28ClF3N6 |
| Molecular Weight | 529.01 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | 5-chloro-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene;5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene |
| SMILES | Clc1ccc2c(n1)NC1CCN2CC1.FC(F)(F)c1cccc(-c2ccc3c(n2)NC2CCN3CC2)c1 |
| InChI | InChI=1S/C17H16F3N3.C10H12ClN3/c18-17(19,20)12-3-1-2-11(10-12)14-4-5-15-16(22-14)21-13-6-8-23(15)9-7-13;11-9-2-1-8-10(13-9)12-7-3-5-14(8)6-4-7/h1-5,10,13H,6-9H2,(H,21,22);1-2,7H,3-6H2,(H,12,13) |
| InChIKey | BLJZSMMFFXCFRS-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.01 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|