C22H12F5N3O2S — CID 157385959
5-[2,6-difluoro-4-[5-(trifluoromethyl)thiophen-3-yl]phenyl]-1-(3H-indol-6-yl)imidazolidine-2,4-dione (PubChem CID 157385959) has the molecular formula C22H12F5N3O2S and a molecular weight of 477.41 g/mol. Its IUPAC name is 5-[2,6-difluoro-4-[5-(trifluoromethyl)thiophen-3-yl]phenyl]-1-(3H-indol-6-yl)imidazolidine-2,4-dione.
| Compound Name | 5-[2,6-difluoro-4-[5-(trifluoromethyl)thiophen-3-yl]phenyl]-1-(3H-indol-6-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 157385959 |
| Molecular Formula | C22H12F5N3O2S |
| Molecular Weight | 477.41 g/mol |
| Exact Mass | 477.06 |
| IUPAC Name | 5-[2,6-difluoro-4-[5-(trifluoromethyl)thiophen-3-yl]phenyl]-1-(3H-indol-6-yl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)N(c2ccc3c(c2)N=CC3)C1c1c(F)cc(-c2csc(C(F)(F)F)c2)cc1F |
| InChI | InChI=1S/C22H12F5N3O2S/c23-14-5-11(12-7-17(33-9-12)22(25,26)27)6-15(24)18(14)19-20(31)29-21(32)30(19)13-2-1-10-3-4-28-16(10)8-13/h1-2,4-9,19H,3H2,(H,29,31,32) |
| InChIKey | RABQCWZHHBLMJN-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.41 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|