About N-[3-chloro-1-(5-methoxy-3-pyridinyl)pyrazol-4-yl]-4,4,4-trifluorobutanamide;methane
N-[3-chloro-1-(5-methoxy-3-pyridinyl)pyrazol-4-yl]-4,4,4-trifluorobutanamide;methane (PubChem CID 157386464) has the molecular formula C14H16ClF3N4O2
and a molecular weight of 364.76 g/mol. Its IUPAC name is N-[3-chloro-1-(5-methoxy-3-pyridinyl)pyrazol-4-yl]-4,4,4-trifluorobutanamide;methane.
Molecular Properties
| Compound Name | N-[3-chloro-1-(5-methoxy-3-pyridinyl)pyrazol-4-yl]-4,4,4-trifluorobutanamide;methane |
| PubChem CID | 157386464 |
| Molecular Formula | C14H16ClF3N4O2 |
| Molecular Weight | 364.76 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | N-[3-chloro-1-(5-methoxy-3-pyridinyl)pyrazol-4-yl]-4,4,4-trifluorobutanamide;methane |
| SMILES | C.COc1cncc(-n2cc(NC(=O)CCC(F)(F)F)c(Cl)n2)c1 |
| InChI | InChI=1S/C13H12ClF3N4O2.CH4/c1-23-9-4-8(5-18-6-9)21-7-10(12(14)20-21)19-11(22)2-3-13(15,16)17;/h4-7H,2-3H2,1H3,(H,19,22);1H4 |
| InChIKey | BLMKWKYASGCSKU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.76 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[3-chloro-1-(5-methoxy-3-pyridinyl)pyrazol-4-yl]-4,4,4-trifluorobutanamide;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-chloro-1-(5-methoxy-3-pyridinyl)pyrazol-4-yl]-4,4,4-trifluorobutanamide;methane?
The IUPAC name of N-[3-chloro-1-(5-methoxy-3-pyridinyl)pyrazol-4-yl]-4,4,4-trifluorobutanamide;methane (CID 157386464) is N-[3-chloro-1-(5-methoxy-3-pyridinyl)pyrazol-4-yl]-4,4,4-trifluorobutanamide;methane.
What is the SMILES notation for N-[3-chloro-1-(5-methoxy-3-pyridinyl)pyrazol-4-yl]-4,4,4-trifluorobutanamide;methane?
The canonical SMILES for N-[3-chloro-1-(5-methoxy-3-pyridinyl)pyrazol-4-yl]-4,4,4-trifluorobutanamide;methane is C.COc1cncc(-n2cc(NC(=O)CCC(F)(F)F)c(Cl)n2)c1.
What is the InChIKey of N-[3-chloro-1-(5-methoxy-3-pyridinyl)pyrazol-4-yl]-4,4,4-trifluorobutanamide;methane?
The InChIKey is BLMKWKYASGCSKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClF3N4O2.CH4/c1-23-9-4-8(5-18-6-9)21-7-10(12(14)20-21)19-11(22)2-3-13(15,16)17;/h4-7H,2-3H2,1H3,(H,19,22);1H4.
What are the key properties of N-[3-chloro-1-(5-methoxy-3-pyridinyl)pyrazol-4-yl]-4,4,4-trifluorobutanamide;methane?
N-[3-chloro-1-(5-methoxy-3-pyridinyl)pyrazol-4-yl]-4,4,4-trifluorobutanamide;methane has a molecular weight of 364.76 g/mol, XLogP of 3.85, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-chloro-1-(5-methoxy-3-pyridinyl)pyrazol-4-yl]-4,4,4-trifluorobutanamide;methane is sourced from PubChem (CID 157386464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).