C21H24N4O3S2 — CID 157387967
S-[(3S,6S,7aR)-6-cyano-2,3,6-trimethyl-1,4-dioxo-3-prop-1-en-2-ylsulfanyl-5-pyrimidin-5-yl-5,7-dihydro-4aH-cyclopenta[c]pyridin-7a-yl] ethanethioate (PubChem CID 157387967) has the molecular formula C21H24N4O3S2 and a molecular weight of 444.58 g/mol. Its IUPAC name is S-[(3S,6S,7aR)-6-cyano-2,3,6-trimethyl-1,4-dioxo-3-prop-1-en-2-ylsulfanyl-5-pyrimidin-5-yl-5,7-dihydro-4aH-cyclopenta[c]pyridin-7a-yl] ethanethioate.
| Compound Name | S-[(3S,6S,7aR)-6-cyano-2,3,6-trimethyl-1,4-dioxo-3-prop-1-en-2-ylsulfanyl-5-pyrimidin-5-yl-5,7-dihydro-4aH-cyclopenta[c]pyridin-7a-yl] ethanethioate |
|---|---|
| PubChem CID | 157387967 |
| Molecular Formula | C21H24N4O3S2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | S-[(3S,6S,7aR)-6-cyano-2,3,6-trimethyl-1,4-dioxo-3-prop-1-en-2-ylsulfanyl-5-pyrimidin-5-yl-5,7-dihydro-4aH-cyclopenta[c]pyridin-7a-yl] ethanethioate |
| SMILES | C=C(C)S[C@@]1(C)C(=O)C2C(c3cncnc3)[C@@](C)(C#N)C[C@]2(SC(C)=O)C(=O)N1C |
| InChI | InChI=1S/C21H24N4O3S2/c1-12(2)29-20(5)17(27)16-15(14-7-23-11-24-8-14)19(4,10-22)9-21(16,30-13(3)26)18(28)25(20)6/h7-8,11,15-16H,1,9H2,2-6H3/t15?,16?,19-,20+,21-/m1/s1 |
| InChIKey | FOOKZTJMVMLJEC-JQSICRHQSA-N |
| XLogP | 3.15 |
| TPSA | 104.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|