C18H17F3N6O — CID 157388054
2-[1-[2-[6-(trifluoromethyl)imidazo[1,2-a]pyrazin-3-yl]pyrimidin-4-yl]piperidin-3-yl]acetaldehyde (PubChem CID 157388054) has the molecular formula C18H17F3N6O and a molecular weight of 390.37 g/mol. Its IUPAC name is 2-[1-[2-[6-(trifluoromethyl)imidazo[1,2-a]pyrazin-3-yl]pyrimidin-4-yl]piperidin-3-yl]acetaldehyde.
| Compound Name | 2-[1-[2-[6-(trifluoromethyl)imidazo[1,2-a]pyrazin-3-yl]pyrimidin-4-yl]piperidin-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 157388054 |
| Molecular Formula | C18H17F3N6O |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 2-[1-[2-[6-(trifluoromethyl)imidazo[1,2-a]pyrazin-3-yl]pyrimidin-4-yl]piperidin-3-yl]acetaldehyde |
| SMILES | O=CCC1CCCN(c2ccnc(-c3cnc4cnc(C(F)(F)F)cn34)n2)C1 |
| InChI | InChI=1S/C18H17F3N6O/c19-18(20,21)14-11-27-13(8-24-16(27)9-23-14)17-22-5-3-15(25-17)26-6-1-2-12(10-26)4-7-28/h3,5,7-9,11-12H,1-2,4,6,10H2 |
| InChIKey | RTDOCHLWZDGEMW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 76.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|