About tributyl-(3,5-dimethyl-1H-pyrazol-4-yl)stannane
tributyl-(3,5-dimethyl-1H-pyrazol-4-yl)stannane (PubChem CID 15738842) has the molecular formula C17H34N2Sn
and a molecular weight of 385.18 g/mol. Its IUPAC name is tributyl-(3,5-dimethyl-1H-pyrazol-4-yl)stannane.
Molecular Properties
| Compound Name | tributyl-(3,5-dimethyl-1H-pyrazol-4-yl)stannane |
| PubChem CID | 15738842 |
| Molecular Formula | C17H34N2Sn |
| Molecular Weight | 385.18 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | tributyl-(3,5-dimethyl-1H-pyrazol-4-yl)stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1c(C)n[nH]c1C |
| InChI | InChI=1S/C5H7N2.3C4H9.Sn/c1-4-3-5(2)7-6-4;3*1-3-4-2;/h1-2H3,(H,6,7);3*1,3-4H2,2H3; |
| InChIKey | QXEVMUDFKAMNDZ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.18 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze tributyl-(3,5-dimethyl-1H-pyrazol-4-yl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl-(3,5-dimethyl-1H-pyrazol-4-yl)stannane?
The IUPAC name of tributyl-(3,5-dimethyl-1H-pyrazol-4-yl)stannane (CID 15738842) is tributyl-(3,5-dimethyl-1H-pyrazol-4-yl)stannane.
What is the SMILES notation for tributyl-(3,5-dimethyl-1H-pyrazol-4-yl)stannane?
The canonical SMILES for tributyl-(3,5-dimethyl-1H-pyrazol-4-yl)stannane is CCCC[Sn](CCCC)(CCCC)c1c(C)n[nH]c1C.
What is the InChIKey of tributyl-(3,5-dimethyl-1H-pyrazol-4-yl)stannane?
The InChIKey is QXEVMUDFKAMNDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N2.3C4H9.Sn/c1-4-3-5(2)7-6-4;3*1-3-4-2;/h1-2H3,(H,6,7);3*1,3-4H2,2H3;.
What are the key properties of tributyl-(3,5-dimethyl-1H-pyrazol-4-yl)stannane?
tributyl-(3,5-dimethyl-1H-pyrazol-4-yl)stannane has a molecular weight of 385.18 g/mol, XLogP of 5.08, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl-(3,5-dimethyl-1H-pyrazol-4-yl)stannane is sourced from PubChem (CID 15738842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).