C20H18I2O+2 — CID 157388486
(4-methoxyphenyl)-(3-phenyliodonio-2-bicyclo[2.2.1]hepta-2,5-dienyl)iodanium (PubChem CID 157388486) has the molecular formula C20H18I2O+2 and a molecular weight of 528.17 g/mol. Its IUPAC name is (4-methoxyphenyl)-(3-phenyliodonio-2-bicyclo[2.2.1]hepta-2,5-dienyl)iodanium.
| Compound Name | (4-methoxyphenyl)-(3-phenyliodonio-2-bicyclo[2.2.1]hepta-2,5-dienyl)iodanium |
|---|---|
| PubChem CID | 157388486 |
| Molecular Formula | C20H18I2O+2 |
| Molecular Weight | 528.17 g/mol |
| Exact Mass | 527.94 |
| IUPAC Name | (4-methoxyphenyl)-(3-phenyliodonio-2-bicyclo[2.2.1]hepta-2,5-dienyl)iodanium |
| SMILES | COc1ccc([I+]C2=C([I+]c3ccccc3)C3C=CC2C3)cc1 |
| InChI | InChI=1S/C20H18I2O/c1-23-18-11-9-17(10-12-18)22-20-15-8-7-14(13-15)19(20)21-16-5-3-2-4-6-16/h2-12,14-15H,13H2,1H3/q+2 |
| InChIKey | NRQPHDNGBXHLAW-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.17 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|