About CID 157388682
CID 157388682 (PubChem CID 157388682) has the molecular formula C18H32BN4O3
and a molecular weight of 363.29 g/mol.
Molecular Properties
| Compound Name | CID 157388682 |
| PubChem CID | 157388682 |
| Molecular Formula | C18H32BN4O3 |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 363.26 |
| IUPAC Name | — |
| SMILES | CC(=O)C1(N=[N+]=[N-])C[C@H]2CNC[C@H]2C1CCC[B]OC(C)(C)C(C)(C)O |
| InChI | InChI=1S/C18H32BN4O3/c1-12(24)18(22-23-20)9-13-10-21-11-14(13)15(18)7-6-8-19-26-17(4,5)16(2,3)25/h13-15,21,25H,6-11H2,1-5H3/t13-,14+,15?,18?/m0/s1 |
| InChIKey | IZAVVKFFPRFZDS-JGTPUYEMSA-N |
| XLogP | 2.86 |
| TPSA | 107.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 157388682 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 157388682?
The IUPAC name of CID 157388682 (CID 157388682) is not available.
What is the SMILES notation for CID 157388682?
The canonical SMILES for CID 157388682 is CC(=O)C1(N=[N+]=[N-])C[C@H]2CNC[C@H]2C1CCC[B]OC(C)(C)C(C)(C)O.
What is the InChIKey of CID 157388682?
The InChIKey is IZAVVKFFPRFZDS-JGTPUYEMSA-N. The full InChI is InChI=1S/C18H32BN4O3/c1-12(24)18(22-23-20)9-13-10-21-11-14(13)15(18)7-6-8-19-26-17(4,5)16(2,3)25/h13-15,21,25H,6-11H2,1-5H3/t13-,14+,15?,18?/m0/s1.
What are the key properties of CID 157388682?
CID 157388682 has a molecular weight of 363.29 g/mol, XLogP of 2.86, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 157388682 is sourced from PubChem (CID 157388682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).