About anthracene;4-sulfanylmorpholine
anthracene;4-sulfanylmorpholine (PubChem CID 157389683) has the molecular formula C18H19NOS
and a molecular weight of 297.42 g/mol. Its IUPAC name is anthracene;4-sulfanylmorpholine.
Molecular Properties
| Compound Name | anthracene;4-sulfanylmorpholine |
| PubChem CID | 157389683 |
| Molecular Formula | C18H19NOS |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | anthracene;4-sulfanylmorpholine |
| SMILES | SN1CCOCC1.c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H10.C4H9NOS/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;7-5-1-3-6-4-2-5/h1-10H;7H,1-4H2 |
| InChIKey | BLVWDWJPHPCREH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 12.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze anthracene;4-sulfanylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene;4-sulfanylmorpholine?
The IUPAC name of anthracene;4-sulfanylmorpholine (CID 157389683) is anthracene;4-sulfanylmorpholine.
What is the SMILES notation for anthracene;4-sulfanylmorpholine?
The canonical SMILES for anthracene;4-sulfanylmorpholine is SN1CCOCC1.c1ccc2cc3ccccc3cc2c1.
What is the InChIKey of anthracene;4-sulfanylmorpholine?
The InChIKey is BLVWDWJPHPCREH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.C4H9NOS/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;7-5-1-3-6-4-2-5/h1-10H;7H,1-4H2.
What are the key properties of anthracene;4-sulfanylmorpholine?
anthracene;4-sulfanylmorpholine has a molecular weight of 297.42 g/mol, XLogP of 4.16, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene;4-sulfanylmorpholine is sourced from PubChem (CID 157389683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).