C26H25FN6O — CID 157389727
1-[3-[6-(3-fluoro-4-piperidin-1-ylanilino)-1H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one (PubChem CID 157389727) has the molecular formula C26H25FN6O and a molecular weight of 456.53 g/mol. Its IUPAC name is 1-[3-[6-(3-fluoro-4-piperidin-1-ylanilino)-1H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one.
| Compound Name | 1-[3-[6-(3-fluoro-4-piperidin-1-ylanilino)-1H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 157389727 |
| Molecular Formula | C26H25FN6O |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | 1-[3-[6-(3-fluoro-4-piperidin-1-ylanilino)-1H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1cccc(-c2nc(Nc3ccc(N4CCCCC4)c(F)c3)nc3[nH]ncc23)c1 |
| InChI | InChI=1S/C26H25FN6O/c1-2-20(34)14-17-7-6-8-18(13-17)24-21-16-28-32-25(21)31-26(30-24)29-19-9-10-23(22(27)15-19)33-11-4-3-5-12-33/h2,6-10,13,15-16H,1,3-5,11-12,14H2,(H2,28,29,30,31,32) |
| InChIKey | XWVNJFRTCKAESC-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|