C15H11ClN2O2 — CID 157390114
1-(2,1,3-benzoxadiazol-5-yl)-3-(4-chlorophenyl)propan-2-one (PubChem CID 157390114) has the molecular formula C15H11ClN2O2 and a molecular weight of 286.72 g/mol. Its IUPAC name is 1-(2,1,3-benzoxadiazol-5-yl)-3-(4-chlorophenyl)propan-2-one.
| Compound Name | 1-(2,1,3-benzoxadiazol-5-yl)-3-(4-chlorophenyl)propan-2-one |
|---|---|
| PubChem CID | 157390114 |
| Molecular Formula | C15H11ClN2O2 |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 1-(2,1,3-benzoxadiazol-5-yl)-3-(4-chlorophenyl)propan-2-one |
| SMILES | O=C(Cc1ccc(Cl)cc1)Cc1ccc2nonc2c1 |
| InChI | InChI=1S/C15H11ClN2O2/c16-12-4-1-10(2-5-12)7-13(19)8-11-3-6-14-15(9-11)18-20-17-14/h1-6,9H,7-8H2 |
| InChIKey | BLXDJUDCJZGOOV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |