C9H14F7NO — CID 157390646
1-(3-ethoxy-1,1,2,2,3,3-hexafluoropropyl)pyrrolidine;hydrofluoride (PubChem CID 157390646) has the molecular formula C9H14F7NO and a molecular weight of 285.20 g/mol. Its IUPAC name is 1-(3-ethoxy-1,1,2,2,3,3-hexafluoropropyl)pyrrolidine;hydrofluoride.
| Compound Name | 1-(3-ethoxy-1,1,2,2,3,3-hexafluoropropyl)pyrrolidine;hydrofluoride |
|---|---|
| PubChem CID | 157390646 |
| Molecular Formula | C9H14F7NO |
| Molecular Weight | 285.20 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 1-(3-ethoxy-1,1,2,2,3,3-hexafluoropropyl)pyrrolidine;hydrofluoride |
| SMILES | CCOC(F)(F)C(F)(F)C(F)(F)N1CCCC1.F |
| InChI | InChI=1S/C9H13F6NO.FH/c1-2-17-9(14,15)7(10,11)8(12,13)16-5-3-4-6-16;/h2-6H2,1H3;1H |
| InChIKey | BLYQLWNMEQQLJQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.20 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|