About decane-1-sulfonic acid
decane-1-sulfonic acid (PubChem CID 157391186) has the molecular formula C20H44O6S2
and a molecular weight of 444.70 g/mol. Its IUPAC name is decane-1-sulfonic acid.
Molecular Properties
| Compound Name | decane-1-sulfonic acid |
| PubChem CID | 157391186 |
| Molecular Formula | C20H44O6S2 |
| Molecular Weight | 444.70 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | decane-1-sulfonic acid |
| SMILES | CCCCCCCCCCS(=O)(=O)O.CCCCCCCCCCS(=O)(=O)O |
| InChI | InChI=1S/2C10H22O3S/c2*1-2-3-4-5-6-7-8-9-10-14(11,12)13/h2*2-10H2,1H3,(H,11,12,13) |
| InChIKey | BMADYNQLHHXDSO-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.70 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze decane-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decane-1-sulfonic acid?
The IUPAC name of decane-1-sulfonic acid (CID 157391186) is decane-1-sulfonic acid.
What is the SMILES notation for decane-1-sulfonic acid?
The canonical SMILES for decane-1-sulfonic acid is CCCCCCCCCCS(=O)(=O)O.CCCCCCCCCCS(=O)(=O)O.
What is the InChIKey of decane-1-sulfonic acid?
The InChIKey is BMADYNQLHHXDSO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H22O3S/c2*1-2-3-4-5-6-7-8-9-10-14(11,12)13/h2*2-10H2,1H3,(H,11,12,13).
What are the key properties of decane-1-sulfonic acid?
decane-1-sulfonic acid has a molecular weight of 444.70 g/mol, XLogP of 6.03, 18 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for decane-1-sulfonic acid is sourced from PubChem (CID 157391186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).