About 2-(cyclohepta-1,3,5-trien-1-ylmethylidene)propanedinitrile
2-(cyclohepta-1,3,5-trien-1-ylmethylidene)propanedinitrile (PubChem CID 15739128) has the molecular formula C11H8N2
and a molecular weight of 168.20 g/mol. Its IUPAC name is 2-(cyclohepta-1,3,5-trien-1-ylmethylidene)propanedinitrile.
Molecular Properties
| Compound Name | 2-(cyclohepta-1,3,5-trien-1-ylmethylidene)propanedinitrile |
| PubChem CID | 15739128 |
| Molecular Formula | C11H8N2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | 2-(cyclohepta-1,3,5-trien-1-ylmethylidene)propanedinitrile |
| SMILES | N#CC(C#N)=CC1=CC=CC=CC1 |
| InChI | InChI=1S/C11H8N2/c12-8-11(9-13)7-10-5-3-1-2-4-6-10/h1-5,7H,6H2 |
| InChIKey | SVNGSEGRACSWFF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(cyclohepta-1,3,5-trien-1-ylmethylidene)propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclohepta-1,3,5-trien-1-ylmethylidene)propanedinitrile?
The IUPAC name of 2-(cyclohepta-1,3,5-trien-1-ylmethylidene)propanedinitrile (CID 15739128) is 2-(cyclohepta-1,3,5-trien-1-ylmethylidene)propanedinitrile.
What is the SMILES notation for 2-(cyclohepta-1,3,5-trien-1-ylmethylidene)propanedinitrile?
The canonical SMILES for 2-(cyclohepta-1,3,5-trien-1-ylmethylidene)propanedinitrile is N#CC(C#N)=CC1=CC=CC=CC1.
What is the InChIKey of 2-(cyclohepta-1,3,5-trien-1-ylmethylidene)propanedinitrile?
The InChIKey is SVNGSEGRACSWFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2/c12-8-11(9-13)7-10-5-3-1-2-4-6-10/h1-5,7H,6H2.
What are the key properties of 2-(cyclohepta-1,3,5-trien-1-ylmethylidene)propanedinitrile?
2-(cyclohepta-1,3,5-trien-1-ylmethylidene)propanedinitrile has a molecular weight of 168.20 g/mol, XLogP of 2.40, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclohepta-1,3,5-trien-1-ylmethylidene)propanedinitrile is sourced from PubChem (CID 15739128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).