About (E)-3-cyclohepta-1,3,5-trien-1-yl-2-formylprop-2-enenitrile
(E)-3-cyclohepta-1,3,5-trien-1-yl-2-formylprop-2-enenitrile (PubChem CID 15739131) has the molecular formula C11H9NO
and a molecular weight of 171.20 g/mol. Its IUPAC name is (E)-3-cyclohepta-1,3,5-trien-1-yl-2-formylprop-2-enenitrile.
Molecular Properties
| Compound Name | (E)-3-cyclohepta-1,3,5-trien-1-yl-2-formylprop-2-enenitrile |
| PubChem CID | 15739131 |
| Molecular Formula | C11H9NO |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | (E)-3-cyclohepta-1,3,5-trien-1-yl-2-formylprop-2-enenitrile |
| SMILES | N#C/C(C=O)=C\C1=CC=CC=CC1 |
| InChI | InChI=1S/C11H9NO/c12-8-11(9-13)7-10-5-3-1-2-4-6-10/h1-5,7,9H,6H2/b11-7+ |
| InChIKey | QITLAILPPVVMSA-YRNVUSSQSA-N |
| XLogP | 2.08 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-cyclohepta-1,3,5-trien-1-yl-2-formylprop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-cyclohepta-1,3,5-trien-1-yl-2-formylprop-2-enenitrile?
The IUPAC name of (E)-3-cyclohepta-1,3,5-trien-1-yl-2-formylprop-2-enenitrile (CID 15739131) is (E)-3-cyclohepta-1,3,5-trien-1-yl-2-formylprop-2-enenitrile.
What is the SMILES notation for (E)-3-cyclohepta-1,3,5-trien-1-yl-2-formylprop-2-enenitrile?
The canonical SMILES for (E)-3-cyclohepta-1,3,5-trien-1-yl-2-formylprop-2-enenitrile is N#C/C(C=O)=C\C1=CC=CC=CC1.
What is the InChIKey of (E)-3-cyclohepta-1,3,5-trien-1-yl-2-formylprop-2-enenitrile?
The InChIKey is QITLAILPPVVMSA-YRNVUSSQSA-N. The full InChI is InChI=1S/C11H9NO/c12-8-11(9-13)7-10-5-3-1-2-4-6-10/h1-5,7,9H,6H2/b11-7+.
What are the key properties of (E)-3-cyclohepta-1,3,5-trien-1-yl-2-formylprop-2-enenitrile?
(E)-3-cyclohepta-1,3,5-trien-1-yl-2-formylprop-2-enenitrile has a molecular weight of 171.20 g/mol, XLogP of 2.08, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-cyclohepta-1,3,5-trien-1-yl-2-formylprop-2-enenitrile is sourced from PubChem (CID 15739131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).